![[ICO]](/icons/blank.gif){kind=icon}
|
Name | Last modified | Size | Description |
|---|---|---|---|---|
|
Parent Directory | - | ||
|
011 | 20-Apr-2018 16:20 | - | |
|
1912 National Calliope | 20-Apr-2018 16:20 | - | |
|
33 AD | 20-Apr-2018 16:20 | - | |
|
604 BPM | 20-Apr-2018 16:20 | - | |
|
68000 | 20-Apr-2018 16:20 | - | |
|
Adam Holt & The Blues Congregation | 20-Apr-2018 16:20 | - | |
|
Adeem | 20-Apr-2018 16:20 | - | |
|
Andrew "telarium" Langley | 20-Apr-2018 16:20 | - | |
|
Annie Gosfield | 20-Apr-2018 16:20 | - | |
|
Antonio Cortés | 20-Apr-2018 16:20 | - | |
|
Arafel | 20-Apr-2018 16:20 | - | |
|
Archie Shepp & Roswell Rudd | 20-Apr-2018 16:20 | - | |
|
Arise and Ruin | 20-Apr-2018 16:20 | - | |
|
Avaritia | 20-Apr-2018 16:20 | - | |
|
Azazel | 20-Apr-2018 16:20 | - | |
|
Bad Machine | 20-Apr-2018 16:20 | - | |
|
Bare Naked Statues | 20-Apr-2018 16:20 | - | |
|
Bayou | 20-Apr-2018 16:20 | - | |
|
Believable Picnic | 20-Apr-2018 16:20 | - | |
|
Bernie Leadon | 20-Apr-2018 16:20 | - | |
|
Billy Wilson | 20-Apr-2018 16:20 | - | |
|
Bitchee Bitchee Ya Ya Ya | 20-Apr-2018 16:20 | - | |
|
Black Sugar | 20-Apr-2018 16:20 | - | |
|
Bow Wow & Omarion | 20-Apr-2018 16:20 | - | |
|
Bruce Henri | 20-Apr-2018 16:20 | - | |
|
Bud Shank with Phil Woods | 20-Apr-2018 16:20 | - | |
|
Budellam | 20-Apr-2018 16:20 | - | |
|
Cahier | 20-Apr-2018 16:20 | - | |
|
Carlos Giffoni and Jim O’Rourke | 20-Apr-2018 16:20 | - | |
|
Carmen Amaya | 20-Apr-2018 16:20 | - | |
|
Catharsis and the Humdrum | 20-Apr-2018 16:20 | - | |
|
Chico Escuela | 20-Apr-2018 16:20 | - | |
|
Chiquinha Gonzaga | 20-Apr-2018 16:20 | - | |
|
Chris Tomasone | 20-Apr-2018 16:20 | - | |
|
Clapan | 20-Apr-2018 16:20 | - | |
|
Clapz II Dogz | 20-Apr-2018 16:20 | - | |
|
Clark Wayne | 20-Apr-2018 16:20 | - | |
|
Clark of Saturn vs. Recone Helmut | 20-Apr-2018 16:20 | - | |
|
Conjure One feat. Leigh Nash | 20-Apr-2018 16:20 | - | |
|
Convaire | 20-Apr-2018 16:20 | - | |
|
Corinne Renaud & Gérard Godon | 20-Apr-2018 16:20 | - | |
|
Coto Normal | 20-Apr-2018 16:20 | - | |
|
D.K. Dance | 20-Apr-2018 16:20 | - | |
|
DJ Epi | 20-Apr-2018 16:20 | - | |
|
DJ Muggs & DJ Warrior | 20-Apr-2018 16:20 | - | |
|
DJ Shyboy | 20-Apr-2018 16:20 | - | |
|
Dadoo | 20-Apr-2018 16:20 | - | |
|
Dan Jones | 20-Apr-2018 16:20 | - | |
|
Dan Michaels | 20-Apr-2018 16:20 | - | |
|
Daniel Riolobos & Ástor Piazzolla | 20-Apr-2018 16:20 | - | |
|
Daniela Castro | 20-Apr-2018 16:20 | - | |
|
Dave Rowe | 20-Apr-2018 16:20 | - | |
|
David Sanchez | 20-Apr-2018 16:20 | - | |
|
David Scaloni | 20-Apr-2018 16:20 | - | |
|
David T. Walker | 20-Apr-2018 16:20 | - | |
|
Ddkern | 20-Apr-2018 16:20 | - | |
|
De Amsterdam Klezmer Band and The Galata Gypsy Band | 20-Apr-2018 16:20 | - | |
|
Dead Relic | 20-Apr-2018 16:20 | - | |
|
Dennis Franke & De Golfbrekers | 20-Apr-2018 16:20 | - | |
|
Dennis Rollins | 20-Apr-2018 16:20 | - | |
|
Designer Drugs feat. Annie | 20-Apr-2018 16:20 | - | |
|
Dick Damron | 20-Apr-2018 16:20 | - | |
|
Die Dr3i | 20-Apr-2018 16:20 | - | |
|
Dig & Mig | 20-Apr-2018 16:20 | - | |
|
Dragonfly | 20-Apr-2018 16:20 | - | |
|
Dschungel Stars | 20-Apr-2018 16:20 | - | |
|
Dulsori | 20-Apr-2018 16:20 | - | |
|
ET-KING | 20-Apr-2018 16:20 | - | |
|
Ebru Berker | 20-Apr-2018 16:20 | - | |
|
Eden's Plot | 20-Apr-2018 16:20 | - | |
|
Emerald City | 20-Apr-2018 16:20 | - | |
|
Emile Ratelband | 20-Apr-2018 16:20 | - | |
|
Eu's Arse | 20-Apr-2018 16:20 | - | |
|
Faruk Demir | 20-Apr-2018 16:20 | - | |
|
Fever Sea | 20-Apr-2018 16:20 | - | |
|
Floorian | 20-Apr-2018 16:20 | - | |
|
Foul Play | 20-Apr-2018 16:20 | - | |
|
Getatchew Mekuria & The Ex & Friends | 20-Apr-2018 16:20 | - | |
|
Gilberto & Adriano | 20-Apr-2018 16:20 | - | |
|
Giuseppe Danise | 20-Apr-2018 16:20 | - | |
|
God's Favorite Drug | 20-Apr-2018 16:20 | - | |
|
Godzik Pink | 20-Apr-2018 16:20 | - | |
|
Golden Dawn | 20-Apr-2018 16:20 | - | |
|
Goodnight From The Desert | 20-Apr-2018 16:20 | - | |
|
Gormoth Iscariot | 20-Apr-2018 16:20 | - | |
|
Greenhouse 27 | 20-Apr-2018 16:20 | - | |
|
Hammer of the Gods | 20-Apr-2018 16:20 | - | |
|
Hans Hagen | 20-Apr-2018 16:20 | - | |
|
Height With Friends | 20-Apr-2018 16:20 | - | |
|
Heraldry | 20-Apr-2018 16:20 | - | |
|
Hip Like [Blank] | 20-Apr-2018 16:20 | - | |
|
Hive & Gridlok | 20-Apr-2018 16:20 | - | |
|
Horsedick | 20-Apr-2018 16:20 | - | |
|
Howler | 20-Apr-2018 16:20 | - | |
|
Huellas Musica De Los Andes | 20-Apr-2018 16:20 | - | |
|
Hundred Strong | 20-Apr-2018 16:20 | - | |
|
I.N.F. | 20-Apr-2018 16:20 | - | |
|
Immortal | 20-Apr-2018 16:20 | - | |
|
Inanimate Objects | 20-Apr-2018 16:20 | - | |
|
Intricated | 20-Apr-2018 16:20 | - | |
|
Iwona Loranc | 20-Apr-2018 16:20 | - | |
|
Jack London | 20-Apr-2018 16:20 | - | |
|
Jack Say and His Orchestra | 20-Apr-2018 16:20 | - | |
|
Jakob Ullmann | 20-Apr-2018 16:20 | - | |
|
Jody Raffoul | 20-Apr-2018 16:20 | - | |
|
John Beckenham & Steve Wickford | 20-Apr-2018 16:20 | - | |
|
Joshua Fisher | 20-Apr-2018 16:20 | - | |
|
Joshua Gabriel | 20-Apr-2018 16:20 | - | |
|
Joyce Andersen | 20-Apr-2018 16:20 | - | |
|
Juanita Williams | 20-Apr-2018 16:20 | - | |
|
Kala | 20-Apr-2018 16:20 | - | |
|
Kaleidoscope | 20-Apr-2018 16:20 | - | |
|
Katharine Whalen | 20-Apr-2018 16:20 | - | |
|
Keith Doder & The Blue City Band | 20-Apr-2018 16:20 | - | |
|
Keith Tucker | 20-Apr-2018 16:20 | - | |
|
Kenny Lattimore & Chanté Moore | 20-Apr-2018 16:20 | - | |
|
Kilima Hawaiians | 20-Apr-2018 16:20 | - | |
|
Kilowatt | 20-Apr-2018 16:20 | - | |
|
Kinnara | 20-Apr-2018 16:20 | - | |
|
Kjehl Johansen | 20-Apr-2018 16:20 | - | |
|
Knox | 20-Apr-2018 16:20 | - | |
|
Kubik | 20-Apr-2018 16:20 | - | |
|
La Clinique | 20-Apr-2018 16:20 | - | |
|
Lincoln Grounds & Vincent Lapie | 20-Apr-2018 16:20 | - | |
|
Lunar Shuttle Disaster | 20-Apr-2018 16:20 | - | |
|
Lustnotes | 20-Apr-2018 16:20 | - | |
|
Madonna Hip Hop Massaker | 20-Apr-2018 16:20 | - | |
|
Manitoba's Wild Kingdom | 20-Apr-2018 16:20 | - | |
|
Marc Twang | 20-Apr-2018 16:20 | - | |
|
Marci Geller | 20-Apr-2018 16:20 | - | |
|
Maria Hörnelius | 20-Apr-2018 16:20 | - | |
|
Mark Shaw | 20-Apr-2018 16:20 | - | |
|
Mary and the Black Lamb | 20-Apr-2018 16:20 | - | |
|
Matto Frank | 20-Apr-2018 16:20 | - | |
|
Max Graham feat. Neev Kennedy | 20-Apr-2018 16:20 | - | |
|
Mestre DeRose | 20-Apr-2018 16:20 | - | |
|
MetroGnom | 20-Apr-2018 16:20 | - | |
|
Michael Kralik | 20-Apr-2018 16:20 | - | |
|
Michaela Foster Marsh | 20-Apr-2018 16:20 | - | |
|
Midnight Well | 20-Apr-2018 16:20 | - | |
|
Misfit Mascottes | 20-Apr-2018 16:20 | - | |
|
Mohave Triangles | 20-Apr-2018 16:20 | - | |
|
Monitor | 20-Apr-2018 16:20 | - | |
|
Mother⁄Father | 20-Apr-2018 16:20 | - | |
|
Motovun | 20-Apr-2018 16:20 | - | |
|
Mr. Credo | 20-Apr-2018 16:20 | - | |
|
NYX | 20-Apr-2018 16:20 | - | |
|
Neighborhood Threat | 20-Apr-2018 16:20 | - | |
|
Nenad Vasilic & Armend Xhaferi | 20-Apr-2018 16:20 | - | |
|
Neomai | 20-Apr-2018 16:20 | - | |
|
Nick Cave & The Go‐Betweens | 20-Apr-2018 16:20 | - | |
|
Nikola Jankov | 20-Apr-2018 16:20 | - | |
|
Ninhato | 20-Apr-2018 16:20 | - | |
|
Nostril Caverns | 20-Apr-2018 16:20 | - | |
|
Noëlle Cordier | 20-Apr-2018 16:20 | - | |
|
Null Factor | 20-Apr-2018 16:20 | - | |
|
Nymph Hutakom | 20-Apr-2018 16:20 | - | |
|
Old Canes | 20-Apr-2018 16:20 | - | |
|
Oscar Key Sung | 20-Apr-2018 16:20 | - | |
|
Pale New Dawn | 20-Apr-2018 16:20 | - | |
|
Paranormal Attack | 20-Apr-2018 16:20 | - | |
|
Pete Grubbs | 20-Apr-2018 16:20 | - | |
|
Phantom Riffage | 20-Apr-2018 16:20 | - | |
|
Philly's Most Wanted | 20-Apr-2018 16:20 | - | |
|
Picari | 20-Apr-2018 16:20 | - | |
|
Pinstripe 45's | 20-Apr-2018 16:20 | - | |
|
Pixie Twins | 20-Apr-2018 16:20 | - | |
|
Plosive | 20-Apr-2018 16:20 | - | |
|
Poets Became Silent | 20-Apr-2018 16:20 | - | |
|
Porcupine Defense | 20-Apr-2018 16:20 | - | |
|
RMS | 20-Apr-2018 16:20 | - | |
|
Rabbit in Red | 20-Apr-2018 16:20 | - | |
|
Rachael Passmore | 20-Apr-2018 16:20 | - | |
|
Raik Wächter | 20-Apr-2018 16:20 | - | |
|
Red Alert | 20-Apr-2018 16:20 | - | |
|
Red Light Rippers | 20-Apr-2018 16:20 | - | |
|
Rescue Mission | 20-Apr-2018 16:20 | - | |
|
Rich Woodson | 20-Apr-2018 16:20 | - | |
|
Richard Polson | 20-Apr-2018 16:20 | - | |
|
Rick Bain | 20-Apr-2018 16:20 | - | |
|
Rob & Gilly Bennett | 20-Apr-2018 16:20 | - | |
|
Ruelgo | 20-Apr-2018 16:20 | - | |
|
SEN | 20-Apr-2018 16:20 | - | |
|
Salvador Candel & Carlos Fiel | 20-Apr-2018 16:20 | - | |
|
Scarlett O'Hara | 20-Apr-2018 16:20 | - | |
|
Shanell feat. Drake & Lil Wayne | 20-Apr-2018 16:20 | - | |
|
Sian Alice Group | 20-Apr-2018 16:20 | - | |
|
Sigmund und seine Freunde | 20-Apr-2018 16:20 | - | |
|
Sinister Footwear | 20-Apr-2018 16:20 | - | |
|
Sinéad Lohan | 20-Apr-2018 16:20 | - | |
|
Snorleifs | 20-Apr-2018 16:20 | - | |
|
Snow Machine | 20-Apr-2018 16:20 | - | |
|
Solaris | 20-Apr-2018 16:20 | - | |
|
Sophy Zoo | 20-Apr-2018 16:20 | - | |
|
Space Eater | 20-Apr-2018 16:20 | - | |
|
Spilled Stout | 20-Apr-2018 16:20 | - | |
|
Spitboy | 20-Apr-2018 16:20 | - | |
|
Surrender the Dance Floor | 20-Apr-2018 16:20 | - | |
|
T-girl | 20-Apr-2018 16:20 | - | |
|
TNVVNüM | 20-Apr-2018 16:20 | - | |
|
Tactequeté | 20-Apr-2018 16:20 | - | |
|
Tara Angell | 20-Apr-2018 16:20 | - | |
|
Telmo de Lima Freitas | 20-Apr-2018 16:20 | - | |
|
Teofilo F. Ruiz | 20-Apr-2018 16:20 | - | |
|
Thatcher on Acid | 20-Apr-2018 16:20 | - | |
|
The Ballroom Band | 20-Apr-2018 16:20 | - | |
|
The Blackstone Valley Sinners | 20-Apr-2018 16:20 | - | |
|
The Charles River Valley Boys | 20-Apr-2018 16:20 | - | |
|
The Commission | 20-Apr-2018 16:20 | - | |
|
The Curse | 20-Apr-2018 16:20 | - | |
|
The High Speed Scene | 20-Apr-2018 16:20 | - | |
|
The Lil' Fighters | 20-Apr-2018 16:20 | - | |
|
The Montgomerys | 20-Apr-2018 16:20 | - | |
|
The Nunchaks | 20-Apr-2018 16:20 | - | |
|
The Saturday Giant | 20-Apr-2018 16:20 | - | |
|
The State | 20-Apr-2018 16:20 | - | |
|
The Tel Aviv Singers & Musicians | 20-Apr-2018 16:20 | - | |
|
The Turpentines | 20-Apr-2018 16:20 | - | |
|
The Underground Cartoons | 20-Apr-2018 16:20 | - | |
|
The Upbeats | 20-Apr-2018 16:20 | - | |
|
The Vontaines | 20-Apr-2018 16:20 | - | |
|
Timet ⁄ Mariposa | 20-Apr-2018 16:20 | - | |
|
Tom Bancroft: Trio Red | 20-Apr-2018 16:20 | - | |
|
Tommy Seebach | 20-Apr-2018 16:20 | - | |
|
Trax Attik | 20-Apr-2018 16:20 | - | |
|
Troglodyte | 20-Apr-2018 16:20 | - | |
|
True Faith | 20-Apr-2018 16:20 | - | |
|
Trujillo & Cuturrufo | 20-Apr-2018 16:20 | - | |
|
USM | 20-Apr-2018 16:20 | - | |
|
Unbroken | 20-Apr-2018 16:20 | - | |
|
Under Sun | 20-Apr-2018 16:20 | - | |
|
Unitz | 20-Apr-2018 16:20 | - | |
|
Vaal | 20-Apr-2018 16:20 | - | |
|
Vango Noir | 20-Apr-2018 16:20 | - | |
|
Viento Celta | 20-Apr-2018 16:20 | - | |
|
Vinkenoog & Spinvis | 20-Apr-2018 16:20 | - | |
|
Wayne Johnson Trio | 20-Apr-2018 16:20 | - | |
|
We Are the Take | 20-Apr-2018 16:20 | - | |
|
Weerthof | 20-Apr-2018 16:20 | - | |
|
Werner Bros. | 20-Apr-2018 16:20 | - | |
|
Willowgreen | 20-Apr-2018 16:20 | - | |
|
Women in Music | 20-Apr-2018 16:20 | - | |
|
Zimoun | 20-Apr-2018 16:20 | - | |
|
dream,フルーツポンチ,SweetS | 20-Apr-2018 16:20 | - | |
|
kimino-museum | 20-Apr-2018 16:20 | - | |
|
world's end boyfriend | 20-Apr-2018 16:20 | - | |
|
Ñejo & Dálmata feat. Arcángel | 20-Apr-2018 16:20 | - | |
|
Θάνος Μικρούτσικος, Κώστας Τριπολίτης & Βασίλης Παπακωνσταντίνου | 20-Apr-2018 16:20 | - | |
|
Νικόλας | 20-Apr-2018 16:20 | - | |
|
ブラックダイヤモンズ | 20-Apr-2018 16:20 | - | |